Difference between revisions of "CPD0-2232"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-L-valyl-Protein == * common-name: ** an n-terminal-l-methionyl-l-valyl-[protein] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9646 == |
* common-name: | * common-name: | ||
| − | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c | ||
| + | * inchi-key: | ||
| + | ** ufphfkctoziafy-ntdveaecsa-l | ||
| + | * molecular-weight: | ||
| + | ** 845.279 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PHOSNACMURPENTATRANS-RXN]] |
| + | * [[RXN-11347]] | ||
| + | * [[RXN-8975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8975]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}} |
| + | {{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}} | ||
| + | {{#set: molecular-weight=845.279}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-9646
- common-name:
- di-trans,octa-cis-undecaprenyl phosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
- inchi-key:
- ufphfkctoziafy-ntdveaecsa-l
- molecular-weight:
- 845.279
