Difference between revisions of "CPD0-2232"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12128 == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD0-2232 == * common-name: ** (s)-3-hydroxyhexadecanoyl-coa * smiles: ** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12128 ==
+
== Metabolite CPD0-2232 ==
 
* common-name:
 
* common-name:
** menaquinol-11
+
** (s)-3-hydroxyhexadecanoyl-coa
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
+
** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** zxhqkrgmwkzwgn-ryzszpjesa-n
+
** dehlmtddpwdrdr-qqojfmbssa-j
 
* molecular-weight:
 
* molecular-weight:
** 923.499
+
** 1017.914
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH7h]]
 +
* [[HACD7h]]
 +
* [[RXN-14271]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9362]]
+
* [[ECOAH7h]]
 +
* [[HACD7h]]
 +
* [[RXN-14271]]
 +
* [[RXN-14272]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-11}}
+
{{#set: common-name=(s)-3-hydroxyhexadecanoyl-coa}}
{{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}}
+
{{#set: inchi-key=inchikey=dehlmtddpwdrdr-qqojfmbssa-j}}
{{#set: molecular-weight=923.499}}
+
{{#set: molecular-weight=1017.914}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-2232

  • common-name:
    • (s)-3-hydroxyhexadecanoyl-coa
  • smiles:
    • cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • dehlmtddpwdrdr-qqojfmbssa-j
  • molecular-weight:
    • 1017.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality