Difference between revisions of "CPD0-2232"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-12128 == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1162 ==
+
== Metabolite CPD-12128 ==
 
* common-name:
 
* common-name:
** (2e,5z)-tetradecenoyl-coa
+
** menaquinol-11
 
* smiles:
 
* smiles:
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
* inchi-key:
** jvefyxpcqbmmaa-zmlwrgbosa-j
+
** zxhqkrgmwkzwgn-ryzszpjesa-n
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 923.499
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5393]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14576]]
+
* [[RXN-9362]]
* [[RXN-17783]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
{{#set: common-name=menaquinol-11}}
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
+
{{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=923.499}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-12128

  • common-name:
    • menaquinol-11
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
  • inchi-key:
    • zxhqkrgmwkzwgn-ryzszpjesa-n
  • molecular-weight:
    • 923.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality