Difference between revisions of "CPD0-2244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20471 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.25.1-RXN ** Catego...")
(Created page with "Category:metabolite == Metabolite CPD0-2244 == * common-name: ** (s)-3-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20471 ==
+
== Metabolite CPD0-2244 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** (s)-3-hydroxydecanoyl-coa
== Reaction(s) associated ==
+
* smiles:
* [[3.4.25.1-RXN]]
+
** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** hivsmyzamunfkz-pnpvfpmqsa-j
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 933.753
 +
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH4h]]
 +
* [[HACD4h]]
 +
* [[RXN-12490]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[ECOAH4h]]
 +
* [[HACD4h]]
 +
* [[RXN-13616]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
 +
{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
 +
{{#set: molecular-weight=933.753}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2244

  • common-name:
    • (s)-3-hydroxydecanoyl-coa
  • smiles:
    • cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • hivsmyzamunfkz-pnpvfpmqsa-j
  • molecular-weight:
    • 933.753

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality