Difference between revisions of "CPD0-2244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...")
(Created page with "Category:metabolite == Metabolite CPD0-2244 == * common-name: ** (s)-3-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6746 ==
+
== Metabolite CPD0-2244 ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 2-monophosphate
+
** (s)-3-hydroxydecanoyl-coa
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1)
+
** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-qwbqgljisa-l
+
** hivsmyzamunfkz-pnpvfpmqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 933.753
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7253]]
+
* [[ECOAH4h]]
 +
* [[HACD4h]]
 +
* [[RXN-12490]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ECOAH4h]]
 +
* [[HACD4h]]
 +
* [[RXN-13616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 2-monophosphate}}
+
{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-qwbqgljisa-l}}
+
{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=933.753}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2244

  • common-name:
    • (s)-3-hydroxydecanoyl-coa
  • smiles:
    • cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • hivsmyzamunfkz-pnpvfpmqsa-j
  • molecular-weight:
    • 933.753

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality