Difference between revisions of "CPD0-2244"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)[o-])...") |
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6746 == |
| + | * common-name: | ||
| + | ** 1d-myo-inositol 2-monophosphate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** inapmgsxuvuwaf-qwbqgljisa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7253]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 2-monophosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-qwbqgljisa-l}} |
| + | {{#set: molecular-weight=258.121}} | ||
Revision as of 18:52, 14 January 2021
Contents
Metabolite CPD-6746
- common-name:
- 1d-myo-inositol 2-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-qwbqgljisa-l
- molecular-weight:
- 258.121
