Difference between revisions of "CPD0-2253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7524 == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c *...") |
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11879 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxymandelate |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rghmisiykihajw-ssdottswsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 183.14 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10912]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxymandelate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.14}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-11879
- common-name:
- 3,4-dihydroxymandelate
- smiles:
- c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
- inchi-key:
- rghmisiykihajw-ssdottswsa-m
- molecular-weight:
- 183.14