Difference between revisions of "CPD0-2253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...") |
(Created page with "Category:metabolite == Metabolite CPD-15692 == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15692 == |
* common-name: | * common-name: | ||
| − | ** 3 | + | ** (3e)-dec-3-enoyl-coa |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-])c( | + | ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqgvnmqhzqjnii-zjzqahhtsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 915.738 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14803]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3 | + | {{#set: common-name=(3e)-dec-3-enoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=915.738}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-15692
- common-name:
- (3e)-dec-3-enoyl-coa
- smiles:
- ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cqgvnmqhzqjnii-zjzqahhtsa-j
- molecular-weight:
- 915.738
