Difference between revisions of "CPD0-2253"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...")
(Created page with "Category:metabolite == Metabolite CPD0-2253 == * common-name: ** (s)-3-hydroxy-stearoyl-coa * smiles: ** cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op(...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11879 ==
+
== Metabolite CPD0-2253 ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxymandelate
+
** (s)-3-hydroxy-stearoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
+
** cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** rghmisiykihajw-ssdottswsa-m
+
** wzmaiegyxcoysh-sfkgbvsgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 183.14
+
** 1045.968
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH8]]
 +
* [[ECOAH8h]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10912]]
+
* [[ECOAH8h]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxymandelate}}
+
{{#set: common-name=(s)-3-hydroxy-stearoyl-coa}}
{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
+
{{#set: inchi-key=inchikey=wzmaiegyxcoysh-sfkgbvsgsa-j}}
{{#set: molecular-weight=183.14}}
+
{{#set: molecular-weight=1045.968}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2253

  • common-name:
    • (s)-3-hydroxy-stearoyl-coa
  • smiles:
    • cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • wzmaiegyxcoysh-sfkgbvsgsa-j
  • molecular-weight:
    • 1045.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality