Difference between revisions of "CPD0-2340"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-365 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-keto-d-chiro-inositol |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vyegbdhsghxogt-qfycrykcsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 178.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14148]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14148]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-keto-d-chiro-inositol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=178.141}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-365
- common-name:
- 1-keto-d-chiro-inositol
- smiles:
- c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
- inchi-key:
- vyegbdhsghxogt-qfycrykcsa-n
- molecular-weight:
- 178.141
