Difference between revisions of "CPD0-2350"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite CPD0-2350 == * common-name: ** a polycistronic trna precursor == Reaction(s) known to consume the compound == * 3.1.27.9-RXN == React...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
+
== Metabolite CPD0-2350 ==
 
* common-name:
 
* common-name:
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+
** a polycistronic trna precursor
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
 
* inchi-key:
 
** bjlpwucpfajinb-uaqstnrtsa-l
 
* molecular-weight:
 
** 442.531
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.42-RXN]]
+
* [[3.1.27.9-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.41-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=a polycistronic trna precursor}}
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
 
{{#set: molecular-weight=442.531}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2350

  • common-name:
    • a polycistronic trna precursor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality