Difference between revisions of "CPD0-2352"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...") |
(Created page with "Category:metabolite == Metabolite MALTOSE == * common-name: ** maltose == Reaction(s) known to consume the compound == * RXN-15910 == Reaction(s) known to produce the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MALTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** maltose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15910]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.1-RXN]] |
| + | * [[RXN0-5183]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=maltose}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite MALTOSE
- common-name:
- maltose
