Difference between revisions of "CPD0-2352"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...") |
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2352 == |
* common-name: | * common-name: | ||
| − | ** 3 | + | ** a trna precursor with a 5' extension and a short 3' extension |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.26.5-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6479]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3 | + | {{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-2352
- common-name:
- a trna precursor with a 5' extension and a short 3' extension
