Difference between revisions of "CPD0-2352"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14925 ==
+
== Metabolite CPD0-2352 ==
 
* common-name:
 
* common-name:
** (3z)-dec-3-enoyl-coa
+
** a trna precursor with a 5' extension and a short 3' extension
* smiles:
 
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** cqgvnmqhzqjnii-uusbzyposa-j
 
* molecular-weight:
 
** 915.738
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.26.5-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17799]]
+
* [[RXN0-6479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
+
{{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}}
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
 
{{#set: molecular-weight=915.738}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-2352

  • common-name:
    • a trna precursor with a 5' extension and a short 3' extension

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality