Difference between revisions of "CPD0-2352"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-SERINE == * common-name: ** a 3-o-sn-phosphatidyl-l-serine == Reaction(s) known to consume the compound == * PHOSPHASE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14925 ==
+
== Metabolite L-1-PHOSPHATIDYL-SERINE ==
 
* common-name:
 
* common-name:
** (3z)-dec-3-enoyl-coa
+
** a 3-o-sn-phosphatidyl-l-serine
* smiles:
 
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** cqgvnmqhzqjnii-uusbzyposa-j
 
* molecular-weight:
 
** 915.738
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-1382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17799]]
+
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-1382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
+
{{#set: common-name=a 3-o-sn-phosphatidyl-l-serine}}
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
 
{{#set: molecular-weight=915.738}}
 

Revision as of 13:12, 14 January 2021

Metabolite L-1-PHOSPHATIDYL-SERINE

  • common-name:
    • a 3-o-sn-phosphatidyl-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality