Difference between revisions of "CPD0-2353"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD0-2353 == * common-name: ** a trna precursor with a short 3' extension == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2353 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trna precursor with a short 3' extension |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.26.5-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trna precursor with a short 3' extension}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD0-2353
- common-name:
- a trna precursor with a short 3' extension
