Difference between revisions of "CPD0-2353"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD-15367 == * common-name: ** auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15367 == |
* common-name: | * common-name: | ||
| − | ** | + | ** auricoloyl-coa |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** ccc=cccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yxbobeundfmucp-ubnaobjysa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1069.99 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16157]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16157]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=auricoloyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yxbobeundfmucp-ubnaobjysa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1069.99}} |
Revision as of 13:07, 14 January 2021
Contents
Metabolite CPD-15367
- common-name:
- auricoloyl-coa
- smiles:
- ccc=cccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yxbobeundfmucp-ubnaobjysa-j
- molecular-weight:
- 1069.99
