Difference between revisions of "CPD0-2472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8074 == * common-name: ** 1-18:3-2-16:0-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8074 ==
+
== Metabolite CPD0-2472 ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:0-monogalactosyldiacylglycerol
+
** (r)-nadhx
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(ccccccccccccccc)=o)=o
+
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
 
* inchi-key:
 
* inchi-key:
** oypveicjgokwfp-fafoyrqusa-n
+
** idbzkgqrlbfufq-mtkbybfrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 753.067
+
** 681.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12752]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8295]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:0-monogalactosyldiacylglycerol}}
+
{{#set: common-name=(r)-nadhx}}
{{#set: inchi-key=inchikey=oypveicjgokwfp-fafoyrqusa-n}}
+
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}}
{{#set: molecular-weight=753.067}}
+
{{#set: molecular-weight=681.445}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2472

  • common-name:
    • (r)-nadhx
  • smiles:
    • c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
  • inchi-key:
    • idbzkgqrlbfufq-mtkbybfrsa-l
  • molecular-weight:
    • 681.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality