Difference between revisions of "CPD0-2474"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite CPD0-2474 == * common-name: ** (s)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2474 == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-nadphx |
+ | * smiles: | ||
+ | ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5) | ||
+ | * inchi-key: | ||
+ | ** szkxtjuokargiy-vphrtnkssa-j | ||
+ | * molecular-weight: | ||
+ | ** 759.41 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13139]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13139]] |
+ | * [[RXN-13142]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-nadphx}} |
+ | {{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}} | ||
+ | {{#set: molecular-weight=759.41}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD0-2474
- common-name:
- (s)-nadphx
- smiles:
- c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
- inchi-key:
- szkxtjuokargiy-vphrtnkssa-j
- molecular-weight:
- 759.41