Difference between revisions of "CPD0-2474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2474 == * common-name: ** (s)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite yW-86 == * common-name: ** 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2474 ==
+
== Metabolite yW-86 ==
 
* common-name:
 
* common-name:
** (s)-nadphx
+
** 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe
* smiles:
 
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 
* inchi-key:
 
** szkxtjuokargiy-vphrtnkssa-j
 
* molecular-weight:
 
** 759.41
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13139]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13139]]
+
* [[RXN-14518]]
* [[RXN-13142]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-nadphx}}
+
{{#set: common-name=7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
 
{{#set: molecular-weight=759.41}}
 

Revision as of 18:57, 14 January 2021

Metabolite yW-86

  • common-name:
    • 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.