Difference between revisions of "CPD0-2500"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] == * direction: ** left-to-right * common-name: ** pterin-4-alpha-carbinolamine...")
 
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] ==
+
== Metabolite CPD0-2500 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** pterin-4-alpha-carbinolamine dehydratase
+
** p-nitrophenyl-α-d-galactopyranoside
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.2.1.96 ec-4.2.1.96]
+
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-5881]][c] '''=>''' 1 [[CPD-14202]][c] '''+''' 1 [[WATER]][c]
+
** ifbhrqdfsncloz-iirvcbmxsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12228]]
+
** 301.252
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-17830]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
* [[PHENYLALANINE-DEG1-PWY]], L-phenylalanine degradation I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-DEG1-PWY PHENYLALANINE-DEG1-PWY]
+
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
** '''1''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=301.252}}
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11921 11921]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R04734 R04734]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=pterin-4-alpha-carbinolamine dehydratase}}
 
{{#set: ec-number=ec-4.2.1.96}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD0-2500

  • common-name:
    • p-nitrophenyl-α-d-galactopyranoside
  • smiles:
    • c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
  • inchi-key:
    • ifbhrqdfsncloz-iirvcbmxsa-n
  • molecular-weight:
    • 301.252

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality