Difference between revisions of "CPD0-2500"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTCP DCTCP] == * direction: ** left-to-right * common-name: ** dctp:cytidine 5'-phosphotransferase...") |
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-2500 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** p-nitrophenyl-α-d-galactopyranoside |
| − | + | * smiles: | |
| − | * | + | ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2) |
| − | = | + | * inchi-key: |
| − | + | ** ifbhrqdfsncloz-iirvcbmxsa-n | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 301.252 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-17830]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}} | |
| − | * | + | {{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}} |
| − | == | + | {{#set: molecular-weight=301.252}} |
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD0-2500
- common-name:
- p-nitrophenyl-α-d-galactopyranoside
- smiles:
- c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
- inchi-key:
- ifbhrqdfsncloz-iirvcbmxsa-n
- molecular-weight:
- 301.252
