Difference between revisions of "CPD0-341"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-132 == * common-name: ** ent-kaur-16-en-19-oate * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c([o-])=o)cccc(c)2[ch]3cc4)))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-341 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-succinyl-dihydrolipoamide |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rjcjwoncskshes-vifpvbqesa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 306.414 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AKGDHe2r]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AKGDHe2r]] |
| + | * [[AKGDHmi]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-succinyl-dihydrolipoamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=306.414}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-341
- common-name:
- s-succinyl-dihydrolipoamide
- smiles:
- c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
- inchi-key:
- rjcjwoncskshes-vifpvbqesa-m
- molecular-weight:
- 306.414
