Difference between revisions of "CPD0-341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12971 RXN-12971] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12971 RXN-12971] ==
+
== Metabolite CPD0-341 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** s-succinyl-dihydrolipoamide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.93 ec-1.3.1.93]
+
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-14406]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14407]][c] '''+''' 1 [[NAD]][c]
+
** rjcjwoncskshes-vifpvbqesa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s) ==
+
** 306.414
−
* [[PWY-7592]], arachidonate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7592 PWY-7592]
+
== Reaction(s) known to consume the compound ==
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[AKGDHe2r]]
−
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
+
== Reaction(s) known to produce the compound ==
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[AKGDHe2r]]
−
== Reconstruction information  ==
+
* [[AKGDHmi]]
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=s-succinyl-dihydrolipoamide}}
−
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
−
{{#set: ec-number=ec-1.3.1.93}}
+
{{#set: molecular-weight=306.414}}
−
{{#set: nb gene associated=0}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=gap-filling}}
 
−
{{#set: reconstruction tool=meneco}}
 
−
{{#set: reconstruction comment=added for gapfilling}}
 
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-341

  • common-name:
    • s-succinyl-dihydrolipoamide
  • smiles:
    • c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
  • inchi-key:
    • rjcjwoncskshes-vifpvbqesa-m
  • molecular-weight:
    • 306.414

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-341&oldid=139671"