Difference between revisions of "CPD0-341"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13303 RXN-13303] == * direction: ** left-to-right * common-name: ** 3-hydroxy-behenoyl-coa dehy...") |
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-341 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** s-succinyl-dihydrolipoamide |
| − | * | + | * smiles: |
| − | ** | + | ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs |
| − | == | + | * inchi-key: |
| − | + | ** rjcjwoncskshes-vifpvbqesa-m | |
| − | + | * molecular-weight: | |
| − | * | + | ** 306.414 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[AKGDHe2r]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | * [[AKGDHe2r]] |
| − | + | * [[AKGDHmi]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=s-succinyl-dihydrolipoamide}} |
| − | + | {{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}} | |
| − | == | + | {{#set: molecular-weight=306.414}} |
| − | * | ||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-341
- common-name:
- s-succinyl-dihydrolipoamide
- smiles:
- c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
- inchi-key:
- rjcjwoncskshes-vifpvbqesa-m
- molecular-weight:
- 306.414
