Difference between revisions of "CPD0-341"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13303 RXN-13303] == * direction: ** left-to-right * common-name: ** 3-hydroxy-behenoyl-coa dehy...") |
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GAMMA-LINOLENOYL-COA == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** γ-linolenoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == | + | * inchi-key: |
| − | + | ** xzqyptbyqyzgru-fhdveodpsa-j | |
| − | = | + | * molecular-weight: |
| − | + | ** 1023.921 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-12777]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[1.14.19.3-RXN]] |
| − | + | * [[RXN-16043]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=γ-linolenoyl-coa}} |
| − | + | {{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}} | |
| − | == | + | {{#set: molecular-weight=1023.921}} |
| − | * | ||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite GAMMA-LINOLENOYL-COA
- common-name:
- γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xzqyptbyqyzgru-fhdveodpsa-j
- molecular-weight:
- 1023.921
