Difference between revisions of "CPD0-341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
(Created page with "Category:metabolite == Metabolite 5-Dephospho-DNA == * common-name: ** a 5'-dephospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-K...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9957 ==
+
== Metabolite 5-Dephospho-DNA ==
 
* common-name:
 
* common-name:
** ubiquinol-9
+
** a 5'-dephospho-[dna]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** npcoqxavbjjzbq-wjnluyjisa-n
 
* molecular-weight:
 
** 797.255
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.64-RXN]]
+
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-9}}
+
{{#set: common-name=a 5'-dephospho-[dna]}}
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
 
{{#set: molecular-weight=797.255}}
 

Revision as of 13:13, 14 January 2021

Metabolite 5-Dephospho-DNA

  • common-name:
    • a 5'-dephospho-[dna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-dephospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.