Difference between revisions of "CPD0-934"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * smiles: ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) * inch...") |
(Created page with "Category:metabolite == Metabolite Dialkyl-phosphates == * common-name: ** a dialkyl phosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Dialkyl-phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dialkyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARYLDIALKYLPHOSPHATASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dialkyl phosphate}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite Dialkyl-phosphates
- common-name:
- a dialkyl phosphate
