Difference between revisions of "CPD0-934"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14216 RXN-14216] == * direction: ** left-to-right == Reaction formula == * 1 DCTP[c] '''+''...") |
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite MESO-DIAMINOPIMELATE == |
| − | * | + | * common-name: |
| − | ** | + | ** meso-diaminopimelate |
| − | + | * smiles: | |
| − | * | + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o |
| − | == | + | * inchi-key: |
| − | * | + | ** gmkmezvlhjarhf-sydprgilsa-n |
| − | * | + | * molecular-weight: |
| − | * | + | ** 190.199 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[DIAMINOPIMDECARB-RXN]] | |
| − | * | + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
| − | == | + | * [[DIAMINOPIMEPIM-RXN]] |
| − | {{#set: | + | * [[RXN-14246]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] | |
| − | {{#set: | + | * [[DIAMINOPIMEPIM-RXN]] |
| − | + | * [[RXN-14246]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=meso-diaminopimelate}} | |
| + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}} | ||
| + | {{#set: molecular-weight=190.199}} | ||
Revision as of 20:36, 18 December 2020
Contents
Metabolite MESO-DIAMINOPIMELATE
- common-name:
- meso-diaminopimelate
- smiles:
- c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
- inchi-key:
- gmkmezvlhjarhf-sydprgilsa-n
- molecular-weight:
- 190.199
