Difference between revisions of "CPD1F-114"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-MethylAdenine-58 == * common-name: ** an n1-methyladenine58 in trna == Reaction(s) known to consume the compound == ==...")
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Containing-N1-MethylAdenine-58 ==
+
== Metabolite CPD1F-114 ==
 
* common-name:
 
* common-name:
** an n1-methyladenine58 in trna
+
** all-trans-lycopene
 +
* smiles:
 +
** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
 +
* inchi-key:
 +
** oaijszizwzsqbc-gyzmgtaesa-n
 +
* molecular-weight:
 +
** 536.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1F-150]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12466]]
+
* [[RXN-8042]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n1-methyladenine58 in trna}}
+
{{#set: common-name=all-trans-lycopene}}
 +
{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
 +
{{#set: molecular-weight=536.882}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD1F-114

  • common-name:
    • all-trans-lycopene
  • smiles:
    • cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • oaijszizwzsqbc-gyzmgtaesa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality