Difference between revisions of "CPD1F-114"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRATE == * common-name: ** 4-aminobutanoate * smiles: ** c(c[n+])cc([o-])=o * inchi-key: ** btcsszjgundroe-uhfffaoysa-n * mole...")
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-AMINO-BUTYRATE ==
+
== Metabolite CPD1F-114 ==
 
* common-name:
 
* common-name:
** 4-aminobutanoate
+
** all-trans-lycopene
 
* smiles:
 
* smiles:
** c(c[n+])cc([o-])=o
+
** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** btcsszjgundroe-uhfffaoysa-n
+
** oaijszizwzsqbc-gyzmgtaesa-n
 
* molecular-weight:
 
* molecular-weight:
** 103.121
+
** 536.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GABATRANSAM-RXN]]
+
* [[RXN1F-150]]
* [[RXN-14209]]
 
* [[TRANS-RXN-261]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GABATRANSAM-RXN]]
+
* [[RXN-8042]]
* [[GLUTDECARBOX-RXN]]
 
* [[RXN-14209]]
 
* [[TRANS-RXN-261]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-aminobutanoate}}
+
{{#set: common-name=all-trans-lycopene}}
{{#set: inchi-key=inchikey=btcsszjgundroe-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
{{#set: molecular-weight=103.121}}
+
{{#set: molecular-weight=536.882}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD1F-114

  • common-name:
    • all-trans-lycopene
  • smiles:
    • cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • oaijszizwzsqbc-gyzmgtaesa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality