Difference between revisions of "CPD1F-120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-352 == * common-name: ** 17β-estradiol * smiles: ** cc12([ch](ccc(o)1)[ch]4([ch](cc2)c3(c(=cc(o)=cc=3)cc4))) * inchi-key: ** vox...") |
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-DEHYDRO-SHIKIMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-dehydroshikimate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** slwwjzmphjjoph-phdidxhhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 171.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] | ||
| + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| + | * [[RXN-7968]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-dehydroshikimate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=171.129}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 3-DEHYDRO-SHIKIMATE
- common-name:
- 3-dehydroshikimate
- smiles:
- c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
- inchi-key:
- slwwjzmphjjoph-phdidxhhsa-m
- molecular-weight:
- 171.129
