Difference between revisions of "CPD1F-120"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11527 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cc(o)cc...")
(Created page with "Category:metabolite == Metabolite CPD1F-120 == * common-name: ** gibberellin a24 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) *...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11527 ==
+
== Metabolite CPD1F-120 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa
+
** gibberellin a24
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** yufhotsrmdfgns-gbypgrtbsa-j
+
** qqrsshfhxysomf-cxxojbqzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 999.813
+
** 344.407
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10703]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10705]]
+
* [[RXN1F-163]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa}}
+
{{#set: common-name=gibberellin a24}}
{{#set: inchi-key=inchikey=yufhotsrmdfgns-gbypgrtbsa-j}}
+
{{#set: inchi-key=inchikey=qqrsshfhxysomf-cxxojbqzsa-l}}
{{#set: molecular-weight=999.813}}
+
{{#set: molecular-weight=344.407}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD1F-120

  • common-name:
    • gibberellin a24
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • qqrsshfhxysomf-cxxojbqzsa-l
  • molecular-weight:
    • 344.407

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality