Difference between revisions of "CPD1F-126"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite 3-UREIDO-PROPIONATE == * common-name: ** 3-ureidopropanoate * smiles: ** c(nc(=o)n)cc([o-])=o * inchi-key: ** jsjwchryrhkbbw-uhfffaoysa-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11938 ==
+
== Metabolite 3-UREIDO-PROPIONATE ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
+
** 3-ureidopropanoate
 
* smiles:
 
* smiles:
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
+
** c(nc(=o)n)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-slwywoedsa-a
+
** jsjwchryrhkbbw-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 131.111
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10965]]
+
* [[BETA-UREIDOPROPIONASE-RXN]]
* [[RXN-10975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.4.24-RXN]]
 
* [[RXN-10965]]
 
* [[RXN-10974]]
 
* [[RXN-10975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=3-ureidopropanoate}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
+
{{#set: inchi-key=inchikey=jsjwchryrhkbbw-uhfffaoysa-m}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=131.111}}

Revision as of 11:15, 15 January 2021

Metabolite 3-UREIDO-PROPIONATE

  • common-name:
    • 3-ureidopropanoate
  • smiles:
    • c(nc(=o)n)cc([o-])=o
  • inchi-key:
    • jsjwchryrhkbbw-uhfffaoysa-m
  • molecular-weight:
    • 131.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality