Difference between revisions of "CPD1F-126"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03071 == * transcription-direction: ** negative * right-end-position: ** 36477 * left-end-position: ** 23232 * centisome-position: ** 18.500498...") |
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD1F-126 == |
| − | * | + | * common-name: |
| − | ** | + | ** γ-carotene |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** hrqkoyfghjyefs-bxolysjbsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 536.882 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN1F-151]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN1F-150]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=γ-carotene}} | |
| − | + | {{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}} | |
| − | + | {{#set: molecular-weight=536.882}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD1F-126
- common-name:
- γ-carotene
- smiles:
- cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
- inchi-key:
- hrqkoyfghjyefs-bxolysjbsa-n
- molecular-weight:
- 536.882
