Difference between revisions of "CPD1F-130"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
(Created page with "Category:metabolite == Metabolite CPD0-2232 == * common-name: ** (s)-3-hydroxyhexadecanoyl-coa * smiles: ** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2232 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (s)-3-hydroxyhexadecanoyl-coa |
* smiles: | * smiles: | ||
− | ** cc(c)c( | + | ** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dehlmtddpwdrdr-qqojfmbssa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1017.914 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ECOAH7h]] |
− | * [[ | + | * [[HACD7h]] |
− | + | * [[RXN-14271]] | |
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ECOAH7h]] |
− | * [[ | + | * [[HACD7h]] |
− | * [[RXN- | + | * [[RXN-14271]] |
− | * [[RXN- | + | * [[RXN-14272]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(s)-3-hydroxyhexadecanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dehlmtddpwdrdr-qqojfmbssa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1017.914}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD0-2232
- common-name:
- (s)-3-hydroxyhexadecanoyl-coa
- smiles:
- cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
- inchi-key:
- dehlmtddpwdrdr-qqojfmbssa-j
- molecular-weight:
- 1017.914