Difference between revisions of "CPD1F-130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20056 == * transcription-direction: ** negative * right-end-position: ** 63195 * left-end-position: ** 57545 * centisome-position: ** 26.837517...")
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20056 ==
+
== Metabolite CPD1F-130 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** zeaxanthin
−
* right-end-position:
+
* smiles:
−
** 63195
+
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
−
* left-end-position:
+
* inchi-key:
−
** 57545
+
** jkqxzkusfckogq-qaybqhtqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 26.837517   
+
** 568.881
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13185]]
−
== Reaction(s) associated ==
+
* [[RXN-7978]]
−
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13185]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7985]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-8026]]
−
** Category: [[annotation]]
+
* [[RXN1F-152]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-12195]]
+
{{#set: common-name=zeaxanthin}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=568.881}}
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=63195}}
 
−
{{#set: left-end-position=57545}}
 
−
{{#set: centisome-position=26.837517    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD1F-130

  • common-name:
    • zeaxanthin
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
  • inchi-key:
    • jkqxzkusfckogq-qaybqhtqsa-n
  • molecular-weight:
    • 568.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-130&oldid=137583"