Difference between revisions of "CPD1F-130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21896 == * transcription-direction: ** negative * right-end-position: ** 474789 * left-end-position: ** 461641 * centisome-position: ** 78.18487...")
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21896 ==
+
== Metabolite CPD1F-130 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** zeaxanthin
−
* right-end-position:
+
* smiles:
−
** 474789
+
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
−
* left-end-position:
+
* inchi-key:
−
** 461641
+
** jkqxzkusfckogq-qaybqhtqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 78.18487   
+
** 568.881
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13185]]
−
== Reaction(s) associated ==
+
* [[RXN-7978]]
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13185]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7985]]
−
* [[RXN-14148]]
+
* [[RXN-8026]]
−
** Category: [[annotation]]
+
* [[RXN1F-152]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) associated ==
+
{{#set: common-name=zeaxanthin}}
−
* [[PWY-5940]]
+
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
−
** '''2''' reactions found over '''18''' reactions in the full pathway
+
{{#set: molecular-weight=568.881}}
−
* [[P562-PWY]]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7241]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7237]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=474789}}
 
−
{{#set: left-end-position=461641}}
 
−
{{#set: centisome-position=78.18487    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD1F-130

  • common-name:
    • zeaxanthin
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
  • inchi-key:
    • jkqxzkusfckogq-qaybqhtqsa-n
  • molecular-weight:
    • 568.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-130&oldid=137583"