Difference between revisions of "CPD1F-130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...")
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Odd-Saturated-Fatty-Acyl-CoA ==
+
== Metabolite CPD1F-130 ==
 
* common-name:
 
* common-name:
** an odd numbered straight chain 2,3,4-saturated fatty acyl coa
+
** zeaxanthin
 +
* smiles:
 +
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
 +
* inchi-key:
 +
** jkqxzkusfckogq-qaybqhtqsa-n
 +
* molecular-weight:
 +
** 568.881
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13185]]
 +
* [[RXN-7978]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-477]]
+
* [[RXN-13185]]
 +
* [[RXN-7985]]
 +
* [[RXN-8026]]
 +
* [[RXN1F-152]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acyl coa}}
+
{{#set: common-name=zeaxanthin}}
 +
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
 +
{{#set: molecular-weight=568.881}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD1F-130

  • common-name:
    • zeaxanthin
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
  • inchi-key:
    • jkqxzkusfckogq-qaybqhtqsa-n
  • molecular-weight:
    • 568.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality