Difference between revisions of "CPD1F-130"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-130 == |
* common-name: | * common-name: | ||
| − | ** | + | ** zeaxanthin |
* smiles: | * smiles: | ||
| − | ** cc(c | + | ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jkqxzkusfckogq-qaybqhtqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 568.881 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13185]] | |
| − | + | * [[RXN-7978]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13185]] |
| − | * [[ | + | * [[RXN-7985]] |
| − | * [[RXN- | + | * [[RXN-8026]] |
| − | * [[ | + | * [[RXN1F-152]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=zeaxanthin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=568.881}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD1F-130
- common-name:
- zeaxanthin
- smiles:
- cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
- inchi-key:
- jkqxzkusfckogq-qaybqhtqsa-n
- molecular-weight:
- 568.881
