Difference between revisions of "CPD1F-130"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (2r,3s)-3-isopropylmalate |
+ | * smiles: | ||
+ | ** cc(c)c(c([o-])=o)c(c([o-])=o)o | ||
+ | * inchi-key: | ||
+ | ** rnqhmtfbussbjq-crclsjgqsa-l | ||
+ | * molecular-weight: | ||
+ | ** 174.153 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3-ISOPROPYLMALDEHYDROG-RXN]] | ||
+ | * [[IMDH]] | ||
+ | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]] | ||
+ | * [[RXN-13158]] | ||
+ | * [[RXN-13163]] | ||
+ | * [[RXN-8991]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3-ISOPROPYLMALDEHYDROG-RXN]] |
+ | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]] | ||
+ | * [[RXN-13163]] | ||
+ | * [[RXN-8991]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2r,3s)-3-isopropylmalate}} |
+ | {{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}} | ||
+ | {{#set: molecular-weight=174.153}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE
- common-name:
- (2r,3s)-3-isopropylmalate
- smiles:
- cc(c)c(c([o-])=o)c(c([o-])=o)o
- inchi-key:
- rnqhmtfbussbjq-crclsjgqsa-l
- molecular-weight:
- 174.153