Difference between revisions of "CPD1F-131"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-131 == |
* common-name: | * common-name: | ||
− | ** | + | ** antheraxanthin |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ofnsuwbaqrchav-oyquvcaxsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 584.881 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7979]] | ||
+ | * [[RXN-7985]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7978]] |
+ | * [[RXN-7984]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=antheraxanthin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=584.881}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD1F-131
- common-name:
- antheraxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
- inchi-key:
- ofnsuwbaqrchav-oyquvcaxsa-n
- molecular-weight:
- 584.881