Difference between revisions of "CPD1F-131"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21294 == * transcription-direction: ** positive * right-end-position: ** 170545 * left-end-position: ** 137602 * centisome-position: ** 70.67531...") |
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD1F-131 == |
− | * | + | * common-name: |
− | ** | + | ** antheraxanthin |
− | * | + | * smiles: |
− | ** | + | ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3) |
− | + | * inchi-key: | |
− | + | ** ofnsuwbaqrchav-oyquvcaxsa-n | |
− | + | * molecular-weight: | |
− | + | ** 584.881 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7979]] | |
− | = | + | * [[RXN-7985]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-7978]] |
− | + | * [[RXN-7984]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=antheraxanthin}} | |
− | + | {{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}} | |
− | + | {{#set: molecular-weight=584.881}} | |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD1F-131
- common-name:
- antheraxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
- inchi-key:
- ofnsuwbaqrchav-oyquvcaxsa-n
- molecular-weight:
- 584.881