Difference between revisions of "CPD1F-131"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-OCTAPRENYLPHENOL ==
+
== Metabolite CPD1F-131 ==
 
* common-name:
 
* common-name:
** 2-octaprenylphenol
+
** antheraxanthin
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
+
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
 
* inchi-key:
 
* inchi-key:
** vunqjppptjiren-cmaxttdksa-n
+
** ofnsuwbaqrchav-oyquvcaxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 639.058
+
** 584.881
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
+
* [[RXN-7979]]
 +
* [[RXN-7985]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7978]]
 +
* [[RXN-7984]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-octaprenylphenol}}
+
{{#set: common-name=antheraxanthin}}
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
+
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
{{#set: molecular-weight=639.058}}
+
{{#set: molecular-weight=584.881}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD1F-131

  • common-name:
    • antheraxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
  • inchi-key:
    • ofnsuwbaqrchav-oyquvcaxsa-n
  • molecular-weight:
    • 584.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality