Difference between revisions of "CPD1F-131"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21726 == * transcription-direction: ** positive * right-end-position: ** 510474 * left-end-position: ** 502500 * centisome-position: ** 84.55667...")
 
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21726 ==
+
== Metabolite CPD1F-131 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** antheraxanthin
−
* right-end-position:
+
* smiles:
−
** 510474
+
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
−
* left-end-position:
+
* inchi-key:
−
** 502500
+
** ofnsuwbaqrchav-oyquvcaxsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 84.55667   
+
** 584.881
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7979]]
−
== Reaction(s) associated ==
+
* [[RXN-7985]]
−
* [[2.3.1.75-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-7978]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7984]]
−
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=antheraxanthin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
−
* [[RXN-12639]]
+
{{#set: molecular-weight=584.881}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9356]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4193]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5885]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5884]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[TRIGLSYN-PWY]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6873]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-282]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=510474}}
 
−
{{#set: left-end-position=502500}}
 
−
{{#set: centisome-position=84.55667    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD1F-131

  • common-name:
    • antheraxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
  • inchi-key:
    • ofnsuwbaqrchav-oyquvcaxsa-n
  • molecular-weight:
    • 584.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-131&oldid=138505"