Difference between revisions of "CPD1F-131"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycogens == * common-name: ** a glycogen == Reaction(s) known to consume the compound == * GLYCOPHOSPHORYL-RXN * GLYMALTOPHOSPHORY...") |
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-131 == |
* common-name: | * common-name: | ||
| − | ** | + | ** antheraxanthin |
| + | * smiles: | ||
| + | ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3) | ||
| + | * inchi-key: | ||
| + | ** ofnsuwbaqrchav-oyquvcaxsa-n | ||
| + | * molecular-weight: | ||
| + | ** 584.881 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7979]] |
| − | * [[ | + | * [[RXN-7985]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7978]] | ||
| + | * [[RXN-7984]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=antheraxanthin}} |
| + | {{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}} | ||
| + | {{#set: molecular-weight=584.881}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD1F-131
- common-name:
- antheraxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
- inchi-key:
- ofnsuwbaqrchav-oyquvcaxsa-n
- molecular-weight:
- 584.881
