Difference between revisions of "CPD1F-132"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...") |
(Created page with "Category:metabolite == Metabolite CPD1F-132 == * common-name: ** ent-kaur-16-en-19-oate * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c([o-])=o)cccc(c)2[ch]3cc4)))) * inchi-ke...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-132 == |
* common-name: | * common-name: | ||
− | ** | + | ** ent-kaur-16-en-19-oate |
* smiles: | * smiles: | ||
− | ** c[ | + | ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c([o-])=o)cccc(c)2[ch]3cc4)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nikhguqulkyige-otcxfqbhsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 301.448 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[1.14.13.79-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7580]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ent-kaur-16-en-19-oate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nikhguqulkyige-otcxfqbhsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=301.448}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD1F-132
- common-name:
- ent-kaur-16-en-19-oate
- smiles:
- c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c([o-])=o)cccc(c)2[ch]3cc4))))
- inchi-key:
- nikhguqulkyige-otcxfqbhsa-m
- molecular-weight:
- 301.448