Difference between revisions of "CPD1F-132"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] == * direction: ** reversible * common-name: ** (s)-3-hydroxydodecanoyl-coa:nad oxidor...")
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] ==
+
== Metabolite CPD-11877 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** (s)-3-hydroxydodecanoyl-coa:nad oxidoreductase
+
** metanephrine
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CPD0-2107]][x] '''+''' 1.0 [[NAD]][x] '''<=>''' 1.0 [[CPD0-2105]][x] '''+''' 1.0 [[NADH]][x] '''+''' 1.0 [[PROTON]][x]
+
** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ03584]]
+
** jwjctzkfygdabj-vifpvbqesa-o
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 198.241
−
* Gene: [[SJ21390]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-10913]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=metanephrine}}
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
−
== External links  ==
+
{{#set: molecular-weight=198.241}}
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=(s)-3-hydroxydodecanoyl-coa:nad oxidoreductase}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-11877

  • common-name:
    • metanephrine
  • smiles:
    • c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
  • inchi-key:
    • jwjctzkfygdabj-vifpvbqesa-o
  • molecular-weight:
    • 198.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-132&oldid=48492"