Difference between revisions of "CPD1F-132"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...") |
(Created page with "Category:metabolite == Metabolite Steryl-Esters == * common-name: ** a steryl-ester == Reaction(s) known to consume the compound == * STEROL-ESTERASE-RXN == Reaction(s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Steryl-Esters == |
* common-name: | * common-name: | ||
| − | ** | + | ** a steryl-ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[STEROL-ESTERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a steryl-ester}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite Steryl-Esters
- common-name:
- a steryl-ester
