Difference between revisions of "CPD1F-135"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite CPD1F-135 == * common-name: ** trans-neoxanthin * smiles: ** cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-135 == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-neoxanthin |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pgyaysrvsajxte-clonmanbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 600.88 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8074]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-155]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-neoxanthin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pgyaysrvsajxte-clonmanbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=600.88}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD1F-135
- common-name:
- trans-neoxanthin
- smiles:
- cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
- inchi-key:
- pgyaysrvsajxte-clonmanbsa-n
- molecular-weight:
- 600.88
